C24H25N5O3 — CID 50788032
1-[2-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-(3,5-dimethoxyphenyl)urea (PubChem CID 50788032) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[2-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-[2-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 50788032 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[2-(3-benzylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCc2nc3cccnc3n2Cc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C24H25N5O3/c1-31-19-13-18(14-20(15-19)32-2)27-24(30)26-12-10-22-28-21-9-6-11-25-23(21)29(22)16-17-7-4-3-5-8-17/h3-9,11,13-15H,10,12,16H2,1-2H3,(H2,26,27,30) |
| InChIKey | ICBMPVOBWQHFDE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |