C24H24N4O2 — CID 46360040
4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3-methoxyphenyl)butanamide (PubChem CID 46360040) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3-methoxyphenyl)butanamide.
| Compound Name | 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46360040 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3-methoxyphenyl)butanamide |
| SMILES | COc1cccc(NC(=O)CCCc2nc3cccnc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O2/c1-30-20-11-5-10-19(16-20)26-23(29)14-6-13-22-27-21-12-7-15-25-24(21)28(22)17-18-8-3-2-4-9-18/h2-5,7-12,15-16H,6,13-14,17H2,1H3,(H,26,29) |
| InChIKey | FDOKUPFKZVHJPJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |