C25H26N4O — CID 46360070
4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3,5-dimethylphenyl)butanamide (PubChem CID 46360070) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3,5-dimethylphenyl)butanamide.
| Compound Name | 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3,5-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 46360070 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-(3-benzylimidazo[4,5-b]pyridin-2-yl)-N-(3,5-dimethylphenyl)butanamide |
| SMILES | Cc1cc(C)cc(NC(=O)CCCc2nc3cccnc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N4O/c1-18-14-19(2)16-21(15-18)27-24(30)12-6-11-23-28-22-10-7-13-26-25(22)29(23)17-20-8-4-3-5-9-20/h3-5,7-10,13-16H,6,11-12,17H2,1-2H3,(H,27,30) |
| InChIKey | OINHXFXJQFJNFC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |