C24H25N5O4 — CID 53021905
1-[2-(2-phenylimidazo[4,5-b]pyridin-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 53021905) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 1-[2-(2-phenylimidazo[4,5-b]pyridin-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-(2-phenylimidazo[4,5-b]pyridin-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 53021905 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-[2-(2-phenylimidazo[4,5-b]pyridin-3-yl)ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCn2c(-c3ccccc3)nc3cccnc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H25N5O4/c1-31-19-14-17(15-20(32-2)21(19)33-3)27-24(30)26-12-13-29-22(16-8-5-4-6-9-16)28-18-10-7-11-25-23(18)29/h4-11,14-15H,12-13H2,1-3H3,(H2,26,27,30) |
| InChIKey | OSKZNAXGJKQQPC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |