C18H17BrF3N5O — CID 50788170
1-(4-bromo-3-methylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea (PubChem CID 50788170) has the molecular formula C18H17BrF3N5O and a molecular weight of 456.27 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea |
|---|---|
| PubChem CID | 50788170 |
| Molecular Formula | C18H17BrF3N5O |
| Molecular Weight | 456.27 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea |
| SMILES | Cc1cc(NC(=O)NCCCn2c(C(F)(F)F)nc3cccnc32)ccc1Br |
| InChI | InChI=1S/C18H17BrF3N5O/c1-11-10-12(5-6-13(11)19)25-17(28)24-8-3-9-27-15-14(4-2-7-23-15)26-16(27)18(20,21)22/h2,4-7,10H,3,8-9H2,1H3,(H2,24,25,28) |
| InChIKey | DWEPTRXORAZSGW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|