C19H20F3N5O — CID 46331573
1-(2,4-dimethylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea (PubChem CID 46331573) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea |
|---|---|
| PubChem CID | 46331573 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[3-[2-(trifluoromethyl)imidazo[4,5-b]pyridin-3-yl]propyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCn2c(C(F)(F)F)nc3cccnc32)c(C)c1 |
| InChI | InChI=1S/C19H20F3N5O/c1-12-6-7-14(13(2)11-12)26-18(28)24-9-4-10-27-16-15(5-3-8-23-16)25-17(27)19(20,21)22/h3,5-8,11H,4,9-10H2,1-2H3,(H2,24,26,28) |
| InChIKey | AINWNOASLQJWGL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|