C11H11ClN2O — CID 57404353
1-[3-(chloromethyl)phenyl]-3-prop-2-ynylurea (PubChem CID 57404353) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 1-[3-(chloromethyl)phenyl]-3-prop-2-ynylurea.
| Compound Name | 1-[3-(chloromethyl)phenyl]-3-prop-2-ynylurea |
|---|---|
| PubChem CID | 57404353 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-[3-(chloromethyl)phenyl]-3-prop-2-ynylurea |
| SMILES | C#CCNC(=O)Nc1cccc(CCl)c1 |
| InChI | InChI=1S/C11H11ClN2O/c1-2-6-13-11(15)14-10-5-3-4-9(7-10)8-12/h1,3-5,7H,6,8H2,(H2,13,14,15) |
| InChIKey | FVJONZRWJFEMKI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|