C9H11ClN2O — CID 141126220
1-[3-(chloromethyl)phenyl]-3-methylurea (PubChem CID 141126220) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 1-[3-(chloromethyl)phenyl]-3-methylurea.
| Compound Name | 1-[3-(chloromethyl)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 141126220 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-[3-(chloromethyl)phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cccc(CCl)c1 |
| InChI | InChI=1S/C9H11ClN2O/c1-11-9(13)12-8-4-2-3-7(5-8)6-10/h2-5H,6H2,1H3,(H2,11,12,13) |
| InChIKey | YDHPFGVWDCZYRM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|