C11H15N3O3 — CID 134123018
[3-(methylcarbamoylamino)phenyl]methyl N-methylcarbamate (PubChem CID 134123018) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is [3-(methylcarbamoylamino)phenyl]methyl N-methylcarbamate.
| Compound Name | [3-(methylcarbamoylamino)phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 134123018 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [3-(methylcarbamoylamino)phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)Nc1cccc(COC(=O)NC)c1 |
| InChI | InChI=1S/C11H15N3O3/c1-12-10(15)14-9-5-3-4-8(6-9)7-17-11(16)13-2/h3-6H,7H2,1-2H3,(H,13,16)(H2,12,14,15) |
| InChIKey | LFZSTMNIBNHXNB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |