C18H20N4O4 — CID 134104797
ethyl 2-[[3-(methylcarbamoylamino)phenyl]carbamoylamino]benzoate (PubChem CID 134104797) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 2-[[3-(methylcarbamoylamino)phenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 2-[[3-(methylcarbamoylamino)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 134104797 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 2-[[3-(methylcarbamoylamino)phenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Nc1cccc(NC(=O)NC)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-3-26-16(23)14-9-4-5-10-15(14)22-18(25)21-13-8-6-7-12(11-13)20-17(24)19-2/h4-11H,3H2,1-2H3,(H2,19,20,24)(H2,21,22,25) |
| InChIKey | HEIMEVJXSGSKFH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |