C12H16N2O3S — CID 61142275
(2R)-2-amino-3-(3-anilino-3-oxopropyl)sulfanylpropanoic acid (PubChem CID 61142275) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-anilino-3-oxopropyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(3-anilino-3-oxopropyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 61142275 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2R)-2-amino-3-(3-anilino-3-oxopropyl)sulfanylpropanoic acid |
| SMILES | N[C@@H](CSCCC(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O3S/c13-10(12(16)17)8-18-7-6-11(15)14-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | XVNCOYFRAMYJRO-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|