C12H18N2OS — CID 66220664
3-(2-aminopropylsulfanyl)-N-phenylpropanamide (PubChem CID 66220664) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-(2-aminopropylsulfanyl)-N-phenylpropanamide.
| Compound Name | 3-(2-aminopropylsulfanyl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 66220664 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-(2-aminopropylsulfanyl)-N-phenylpropanamide |
| SMILES | CC(N)CSCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H18N2OS/c1-10(13)9-16-8-7-12(15)14-11-5-3-2-4-6-11/h2-6,10H,7-9,13H2,1H3,(H,14,15) |
| InChIKey | QTQJGPNGTPNKKX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|