C12H15ClN2O3S — CID 107773489
(2S)-2-amino-3-[3-(2-chloroanilino)-3-oxopropyl]sulfanylpropanoic acid (PubChem CID 107773489) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(2-chloroanilino)-3-oxopropyl]sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(2-chloroanilino)-3-oxopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107773489 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (2S)-2-amino-3-[3-(2-chloroanilino)-3-oxopropyl]sulfanylpropanoic acid |
| SMILES | N[C@H](CSCCC(=O)Nc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H15ClN2O3S/c13-8-3-1-2-4-10(8)15-11(16)5-6-19-7-9(14)12(17)18/h1-4,9H,5-7,14H2,(H,15,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | SOXVRSFQNSAAJM-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|