C13H16Cl2N2O3S — CID 60920432
2-amino-4-[3-(2,5-dichloroanilino)-3-oxopropyl]sulfanylbutanoic acid (PubChem CID 60920432) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 2-amino-4-[3-(2,5-dichloroanilino)-3-oxopropyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-(2,5-dichloroanilino)-3-oxopropyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60920432 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-amino-4-[3-(2,5-dichloroanilino)-3-oxopropyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(=O)Nc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H16Cl2N2O3S/c14-8-1-2-9(15)11(7-8)17-12(18)4-6-21-5-3-10(16)13(19)20/h1-2,7,10H,3-6,16H2,(H,17,18)(H,19,20) |
| InChIKey | AAKXUUXSDKLLAI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|