C12H15Cl2NO3S — CID 54933483
2-amino-4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]butanoic acid (PubChem CID 54933483) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-amino-4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 54933483 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-amino-4-[2-(2,4-dichlorophenoxy)ethylsulfanyl]butanoic acid |
| SMILES | NC(CCSCCOc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H15Cl2NO3S/c13-8-1-2-11(9(14)7-8)18-4-6-19-5-3-10(15)12(16)17/h1-2,7,10H,3-6,15H2,(H,16,17) |
| InChIKey | OMXJBNWWUDGMCJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|