C11H14ClNO3S — CID 93031277
(2S)-2-amino-3-[2-(2-chlorophenoxy)ethylsulfanyl]propanoic acid (PubChem CID 93031277) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(2-chlorophenoxy)ethylsulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(2-chlorophenoxy)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 93031277 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (2S)-2-amino-3-[2-(2-chlorophenoxy)ethylsulfanyl]propanoic acid |
| SMILES | N[C@H](CSCCOc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H14ClNO3S/c12-8-3-1-2-4-10(8)16-5-6-17-7-9(13)11(14)15/h1-4,9H,5-7,13H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | GLSKEIRXBBLCJM-SECBINFHSA-N |
| XLogP | 1.86 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|