C27H26ClNO5S — CID 113236041
4-[2-(2-chlorophenoxy)ethylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (PubChem CID 113236041) has the molecular formula C27H26ClNO5S and a molecular weight of 512.03 g/mol. Its IUPAC name is 4-[2-(2-chlorophenoxy)ethylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[2-(2-chlorophenoxy)ethylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 113236041 |
| Molecular Formula | C27H26ClNO5S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 4-[2-(2-chlorophenoxy)ethylsulfanyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(NC(CCSCCOc1ccccc1Cl)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26ClNO5S/c28-23-11-5-6-12-25(23)33-14-16-35-15-13-24(26(30)31)29-27(32)34-17-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-12,22,24H,13-17H2,(H,29,32)(H,30,31) |
| InChIKey | IEWRPOSWBYHQOR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|