C12H13ClO5 — CID 174289413
2-[3-(2-chlorophenoxy)propyl]propanedioic acid (PubChem CID 174289413) has the molecular formula C12H13ClO5 and a molecular weight of 272.68 g/mol. Its IUPAC name is 2-[3-(2-chlorophenoxy)propyl]propanedioic acid.
| Compound Name | 2-[3-(2-chlorophenoxy)propyl]propanedioic acid |
|---|---|
| PubChem CID | 174289413 |
| Molecular Formula | C12H13ClO5 |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-[3-(2-chlorophenoxy)propyl]propanedioic acid |
| SMILES | O=C(O)C(CCCOc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13ClO5/c13-9-5-1-2-6-10(9)18-7-3-4-8(11(14)15)12(16)17/h1-2,5-6,8H,3-4,7H2,(H,14,15)(H,16,17) |
| InChIKey | VJJYPLUDWLMVCL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|