C12H14ClNO5 — CID 63646826
2-[carboxymethyl-[2-(2-chlorophenoxy)ethyl]amino]acetic acid (PubChem CID 63646826) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(2-chlorophenoxy)ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(2-chlorophenoxy)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 63646826 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[carboxymethyl-[2-(2-chlorophenoxy)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCOc1ccccc1Cl)CC(=O)O |
| InChI | InChI=1S/C12H14ClNO5/c13-9-3-1-2-4-10(9)19-6-5-14(7-11(15)16)8-12(17)18/h1-4H,5-8H2,(H,15,16)(H,17,18) |
| InChIKey | ZQRWASFVEYWSNV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |