C16H24ClNO3 — CID 65289047
6-[2-(2-chlorophenoxy)ethylamino]-2-methylheptanoic acid (PubChem CID 65289047) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 6-[2-(2-chlorophenoxy)ethylamino]-2-methylheptanoic acid.
| Compound Name | 6-[2-(2-chlorophenoxy)ethylamino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 65289047 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 6-[2-(2-chlorophenoxy)ethylamino]-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H24ClNO3/c1-12(16(19)20)6-5-7-13(2)18-10-11-21-15-9-4-3-8-14(15)17/h3-4,8-9,12-13,18H,5-7,10-11H2,1-2H3,(H,19,20) |
| InChIKey | ASAZUPKNMYGSHA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|