C16H11Cl5O4 — CID 57350820
2-(2,4-dichlorophenoxy)-4-(2,4,5-trichlorophenoxy)butanoic acid (PubChem CID 57350820) has the molecular formula C16H11Cl5O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-4-(2,4,5-trichlorophenoxy)butanoic acid.
| Compound Name | 2-(2,4-dichlorophenoxy)-4-(2,4,5-trichlorophenoxy)butanoic acid |
|---|---|
| PubChem CID | 57350820 |
| Molecular Formula | C16H11Cl5O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 441.91 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-4-(2,4,5-trichlorophenoxy)butanoic acid |
| SMILES | O=C(O)C(CCOc1cc(Cl)c(Cl)cc1Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl5O4/c17-8-1-2-13(11(20)5-8)25-14(16(22)23)3-4-24-15-7-10(19)9(18)6-12(15)21/h1-2,5-7,14H,3-4H2,(H,22,23) |
| InChIKey | YNAVHPZWVIJKDT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|