C10H6Cl5O3- — CID 57371473
4,4,4-trichloro-2-(2,4-dichlorophenoxy)butanoate (PubChem CID 57371473) has the molecular formula C10H6Cl5O3- and a molecular weight of 351.42 g/mol. Its IUPAC name is 4,4,4-trichloro-2-(2,4-dichlorophenoxy)butanoate.
| Compound Name | 4,4,4-trichloro-2-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 57371473 |
| Molecular Formula | C10H6Cl5O3- |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 348.88 |
| IUPAC Name | 4,4,4-trichloro-2-(2,4-dichlorophenoxy)butanoate |
| SMILES | O=C([O-])C(CC(Cl)(Cl)Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl5O3/c11-5-1-2-7(6(12)3-5)18-8(9(16)17)4-10(13,14)15/h1-3,8H,4H2,(H,16,17)/p-1 |
| InChIKey | WBZVTYXFFARSED-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|