C18H18Cl4O3 — CID 13326121
1,1-bis(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-ol (PubChem CID 13326121) has the molecular formula C18H18Cl4O3 and a molecular weight of 424.15 g/mol. Its IUPAC name is 1,1-bis(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-ol.
| Compound Name | 1,1-bis(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 13326121 |
| Molecular Formula | C18H18Cl4O3 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 1,1-bis(2,4-dichlorophenoxy)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)C(Oc1ccc(Cl)cc1Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl4O3/c1-18(2,3)16(23)17(24-14-6-4-10(19)8-12(14)21)25-15-7-5-11(20)9-13(15)22/h4-9,16-17,23H,1-3H3 |
| InChIKey | PGIPYNXYFKUSBS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|