C16H16Cl6O5P+ — CID 88780474
dichloro(oxo)phosphanium;bis(1-(2,4-dichlorophenoxy)ethanol) (PubChem CID 88780474) has the molecular formula C16H16Cl6O5P+ and a molecular weight of 531.99 g/mol. Its IUPAC name is dichloro(oxo)phosphanium;bis(1-(2,4-dichlorophenoxy)ethanol).
| Compound Name | dichloro(oxo)phosphanium;bis(1-(2,4-dichlorophenoxy)ethanol) |
|---|---|
| PubChem CID | 88780474 |
| Molecular Formula | C16H16Cl6O5P+ |
| Molecular Weight | 531.99 g/mol |
| Exact Mass | 528.89 |
| IUPAC Name | dichloro(oxo)phosphanium;bis(1-(2,4-dichlorophenoxy)ethanol) |
| SMILES | CC(O)Oc1ccc(Cl)cc1Cl.CC(O)Oc1ccc(Cl)cc1Cl.O=[P+](Cl)Cl |
| InChI | InChI=1S/2C8H8Cl2O2.Cl2OP/c2*1-5(11)12-8-3-2-6(9)4-7(8)10;1-4(2)3/h2*2-5,11H,1H3;/q;;+1 |
| InChIKey | LVHWAFXCPCBEED-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.99 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|