C9H10Cl2N2O2 — CID 7222417
(2R)-2-(2,4-dichlorophenoxy)-N'-hydroxypropanimidamide (PubChem CID 7222417) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N'-hydroxypropanimidamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 7222417 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N'-hydroxypropanimidamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)/C(N)=N\O |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-5(9(12)13-14)15-8-3-2-6(10)4-7(8)11/h2-5,14H,1H3,(H2,12,13)/t5-/m1/s1 |
| InChIKey | KCEKHBDQRWJTKG-RXMQYKEDSA-N |
| XLogP | 2.51 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|