C9H10Cl2O2 — CID 3017057
1-(2,4-dichlorophenoxy)propan-1-ol (PubChem CID 3017057) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is 1-(2,4-dichlorophenoxy)propan-1-ol.
| Compound Name | 1-(2,4-dichlorophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 3017057 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 1-(2,4-dichlorophenoxy)propan-1-ol |
| SMILES | CCC(O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2O2/c1-2-9(12)13-8-4-3-6(10)5-7(8)11/h3-5,9,12H,2H2,1H3 |
| InChIKey | YPBXFEZZIARTHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|