C11H14Cl2O4S — CID 88683157
3-(2,4-dichlorophenoxy)pentane-1-sulfonic acid (PubChem CID 88683157) has the molecular formula C11H14Cl2O4S and a molecular weight of 313.20 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)pentane-1-sulfonic acid.
| Compound Name | 3-(2,4-dichlorophenoxy)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 88683157 |
| Molecular Formula | C11H14Cl2O4S |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)pentane-1-sulfonic acid |
| SMILES | CCC(CCS(=O)(=O)O)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2O4S/c1-2-9(5-6-18(14,15)16)17-11-4-3-8(12)7-10(11)13/h3-4,7,9H,2,5-6H2,1H3,(H,14,15,16) |
| InChIKey | CBJQXFAJWJROTC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|