C18H21Cl2NO — CID 70632627
N-[2-(2,4-dichlorophenoxy)butyl]-N-ethylaniline (PubChem CID 70632627) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)butyl]-N-ethylaniline.
| Compound Name | N-[2-(2,4-dichlorophenoxy)butyl]-N-ethylaniline |
|---|---|
| PubChem CID | 70632627 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)butyl]-N-ethylaniline |
| SMILES | CCC(CN(CC)c1ccccc1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2NO/c1-3-16(22-18-11-10-14(19)12-17(18)20)13-21(4-2)15-8-6-5-7-9-15/h5-12,16H,3-4,13H2,1-2H3 |
| InChIKey | VAFMFVNSSITJNK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |