C17H18Cl3NO — CID 70632637
3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-propylaniline (PubChem CID 70632637) has the molecular formula C17H18Cl3NO and a molecular weight of 358.70 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-propylaniline.
| Compound Name | 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-propylaniline |
|---|---|
| PubChem CID | 70632637 |
| Molecular Formula | C17H18Cl3NO |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-propylaniline |
| SMILES | CCCN(c1cccc(Cl)c1)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl3NO/c1-3-9-21(15-6-4-5-13(18)10-15)12(2)22-17-8-7-14(19)11-16(17)20/h4-8,10-12H,3,9H2,1-2H3 |
| InChIKey | MKPNMTADERSLTQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|