C15H14Cl3NO — CID 70632825
3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-methylaniline (PubChem CID 70632825) has the molecular formula C15H14Cl3NO and a molecular weight of 330.64 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-methylaniline.
| Compound Name | 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-methylaniline |
|---|---|
| PubChem CID | 70632825 |
| Molecular Formula | C15H14Cl3NO |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 3-chloro-N-[1-(2,4-dichlorophenoxy)ethyl]-N-methylaniline |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)N(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14Cl3NO/c1-10(19(2)13-5-3-4-11(16)8-13)20-15-7-6-12(17)9-14(15)18/h3-10H,1-2H3 |
| InChIKey | KLFWKJFTMYBFKG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|