C13H20Cl3NO — CID 69456701
(3R)-3-(2,4-dichlorophenoxy)-N-methylhexan-1-amine;hydrochloride (PubChem CID 69456701) has the molecular formula C13H20Cl3NO and a molecular weight of 312.67 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenoxy)-N-methylhexan-1-amine;hydrochloride.
| Compound Name | (3R)-3-(2,4-dichlorophenoxy)-N-methylhexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 69456701 |
| Molecular Formula | C13H20Cl3NO |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenoxy)-N-methylhexan-1-amine;hydrochloride |
| SMILES | CCC[C@H](CCNC)Oc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C13H19Cl2NO.ClH/c1-3-4-11(7-8-16-2)17-13-6-5-10(14)9-12(13)15;/h5-6,9,11,16H,3-4,7-8H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | GBRAATYCHQMGPG-RFVHGSKJSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |