C14H19ClF3NO — CID 11624379
(3R)-3-[2-chloro-3-(trifluoromethyl)phenoxy]-N-methylhexan-1-amine (PubChem CID 11624379) has the molecular formula C14H19ClF3NO and a molecular weight of 309.76 g/mol. Its IUPAC name is (3R)-3-[2-chloro-3-(trifluoromethyl)phenoxy]-N-methylhexan-1-amine.
| Compound Name | (3R)-3-[2-chloro-3-(trifluoromethyl)phenoxy]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 11624379 |
| Molecular Formula | C14H19ClF3NO |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3R)-3-[2-chloro-3-(trifluoromethyl)phenoxy]-N-methylhexan-1-amine |
| SMILES | CCC[C@H](CCNC)Oc1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C14H19ClF3NO/c1-3-5-10(8-9-19-2)20-12-7-4-6-11(13(12)15)14(16,17)18/h4,6-7,10,19H,3,5,8-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | VBJVBBMFWPADIS-SNVBAGLBSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |