C11H14Cl2F3N — CID 171207579
(1R)-1-[2-chloro-6-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride (PubChem CID 171207579) has the molecular formula C11H14Cl2F3N and a molecular weight of 288.14 g/mol. Its IUPAC name is (1R)-1-[2-chloro-6-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-chloro-6-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171207579 |
| Molecular Formula | C11H14Cl2F3N |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (1R)-1-[2-chloro-6-(trifluoromethyl)phenyl]butan-1-amine;hydrochloride |
| SMILES | CCC[C@@H](N)c1c(Cl)cccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C11H13ClF3N.ClH/c1-2-4-9(16)10-7(11(13,14)15)5-3-6-8(10)12;/h3,5-6,9H,2,4,16H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | IXDRATUKQISBEQ-SBSPUUFOSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |