C10H11Cl2F4N — CID 171227171
(1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine;hydrochloride (PubChem CID 171227171) has the molecular formula C10H11Cl2F4N and a molecular weight of 292.10 g/mol. Its IUPAC name is (1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227171 |
| Molecular Formula | C10H11Cl2F4N |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (1S)-1-[2-chloro-6-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCF)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H10ClF4N.ClH/c11-7-3-1-2-6(10(13,14)15)9(7)8(16)4-5-12;/h1-3,8H,4-5,16H2;1H/t8-;/m0./s1 |
| InChIKey | PVKZZEINJVEKAH-QRPNPIFTSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |