C10H11ClF3N — CID 117347970
2-[2-chloro-6-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 117347970) has the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-[2-chloro-6-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 2-[2-chloro-6-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 117347970 |
| Molecular Formula | C10H11ClF3N |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-[2-chloro-6-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CC(CN)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N/c1-6(5-15)9-7(10(12,13)14)3-2-4-8(9)11/h2-4,6H,5,15H2,1H3 |
| InChIKey | YFKUOVFOJBEAJY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |