C12H9ClF3NS — CID 171227181
(S)-[2-chloro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine (PubChem CID 171227181) has the molecular formula C12H9ClF3NS and a molecular weight of 291.73 g/mol. Its IUPAC name is (S)-[2-chloro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine.
| Compound Name | (S)-[2-chloro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171227181 |
| Molecular Formula | C12H9ClF3NS |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (S)-[2-chloro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
| SMILES | N[C@@H](c1ccsc1)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NS/c13-9-3-1-2-8(12(14,15)16)10(9)11(17)7-4-5-18-6-7/h1-6,11H,17H2/t11-/m0/s1 |
| InChIKey | CJZHWJVLEWHPJF-NSHDSACASA-N |
| XLogP | 4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |