C12H8ClF4NS — CID 171228865
(R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine (PubChem CID 171228865) has the molecular formula C12H8ClF4NS and a molecular weight of 309.72 g/mol. Its IUPAC name is (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine.
| Compound Name | (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171228865 |
| Molecular Formula | C12H8ClF4NS |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | (R)-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
| SMILES | N[C@@H](c1ccsc1)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C12H8ClF4NS/c13-8-2-1-7(12(15,16)17)9(10(8)14)11(18)6-3-4-19-5-6/h1-5,11H,18H2/t11-/m0/s1 |
| InChIKey | ARYOVDJEHKBLEW-NSHDSACASA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |