C12H9F4NS — CID 171207818
(S)-[2-fluoro-3-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine (PubChem CID 171207818) has the molecular formula C12H9F4NS and a molecular weight of 275.27 g/mol. Its IUPAC name is (S)-[2-fluoro-3-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine.
| Compound Name | (S)-[2-fluoro-3-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171207818 |
| Molecular Formula | C12H9F4NS |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (S)-[2-fluoro-3-(trifluoromethyl)phenyl]-thiophen-3-ylmethanamine |
| SMILES | N[C@H](c1ccsc1)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H9F4NS/c13-10-8(11(17)7-4-5-18-6-7)2-1-3-9(10)12(14,15)16/h1-6,11H,17H2/t11-/m1/s1 |
| InChIKey | YHEAWOUFGWQJDU-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |