C11H7F4NS — CID 171210488
(S)-(2,3,5,6-tetrafluorophenyl)-thiophen-3-ylmethanamine (PubChem CID 171210488) has the molecular formula C11H7F4NS and a molecular weight of 261.24 g/mol. Its IUPAC name is (S)-(2,3,5,6-tetrafluorophenyl)-thiophen-3-ylmethanamine.
| Compound Name | (S)-(2,3,5,6-tetrafluorophenyl)-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 171210488 |
| Molecular Formula | C11H7F4NS |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (S)-(2,3,5,6-tetrafluorophenyl)-thiophen-3-ylmethanamine |
| SMILES | N[C@H](c1ccsc1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H7F4NS/c12-6-3-7(13)10(15)8(9(6)14)11(16)5-1-2-17-4-5/h1-4,11H,16H2/t11-/m1/s1 |
| InChIKey | AJBBRBGNLMXZHH-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|