C11H12ClNO3S — CID 171217050
2-[(S)-amino(thiophen-3-yl)methyl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171217050) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-[(S)-amino(thiophen-3-yl)methyl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(S)-amino(thiophen-3-yl)methyl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171217050 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-[(S)-amino(thiophen-3-yl)methyl]benzene-1,3,5-triol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccsc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C11H11NO3S.ClH/c12-11(6-1-2-16-5-6)10-8(14)3-7(13)4-9(10)15;/h1-5,11,13-15H,12H2;1H/t11-;/m1./s1 |
| InChIKey | ONZWPCRYTOYJPT-RFVHGSKJSA-N |
| XLogP | 2.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|