C11H8Br3NOS — CID 171216422
3-[(R)-amino(thiophen-3-yl)methyl]-2,4,6-tribromophenol (PubChem CID 171216422) has the molecular formula C11H8Br3NOS and a molecular weight of 441.97 g/mol. Its IUPAC name is 3-[(R)-amino(thiophen-3-yl)methyl]-2,4,6-tribromophenol.
| Compound Name | 3-[(R)-amino(thiophen-3-yl)methyl]-2,4,6-tribromophenol |
|---|---|
| PubChem CID | 171216422 |
| Molecular Formula | C11H8Br3NOS |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 438.79 |
| IUPAC Name | 3-[(R)-amino(thiophen-3-yl)methyl]-2,4,6-tribromophenol |
| SMILES | N[C@H](c1ccsc1)c1c(Br)cc(Br)c(O)c1Br |
| InChI | InChI=1S/C11H8Br3NOS/c12-6-3-7(13)11(16)9(14)8(6)10(15)5-1-2-17-4-5/h1-4,10,16H,15H2/t10-/m1/s1 |
| InChIKey | XSMZACHXVRVEDS-SNVBAGLBSA-N |
| XLogP | 4.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |