C11H7ClF5NS — CID 171210314
(S)-(2,3,4,5,6-pentafluorophenyl)-thiophen-3-ylmethanamine;hydrochloride (PubChem CID 171210314) has the molecular formula C11H7ClF5NS and a molecular weight of 315.69 g/mol. Its IUPAC name is (S)-(2,3,4,5,6-pentafluorophenyl)-thiophen-3-ylmethanamine;hydrochloride.
| Compound Name | (S)-(2,3,4,5,6-pentafluorophenyl)-thiophen-3-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171210314 |
| Molecular Formula | C11H7ClF5NS |
| Molecular Weight | 315.69 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (S)-(2,3,4,5,6-pentafluorophenyl)-thiophen-3-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccsc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H6F5NS.ClH/c12-6-5(11(17)4-1-2-18-3-4)7(13)9(15)10(16)8(6)14;/h1-3,11H,17H2;1H/t11-;/m1./s1 |
| InChIKey | FGHNSEGUVVZDPS-RFVHGSKJSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|