C10H9ClF4 — CID 58901637
1-chloro-2-fluoro-3-propan-2-yl-4-(trifluoromethyl)benzene (PubChem CID 58901637) has the molecular formula C10H9ClF4 and a molecular weight of 240.63 g/mol. Its IUPAC name is 1-chloro-2-fluoro-3-propan-2-yl-4-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-2-fluoro-3-propan-2-yl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 58901637 |
| Molecular Formula | C10H9ClF4 |
| Molecular Weight | 240.63 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-chloro-2-fluoro-3-propan-2-yl-4-(trifluoromethyl)benzene |
| SMILES | CC(C)c1c(C(F)(F)F)ccc(Cl)c1F |
| InChI | InChI=1S/C10H9ClF4/c1-5(2)8-6(10(13,14)15)3-4-7(11)9(8)12/h3-5H,1-2H3 |
| InChIKey | AQIHOTNMWKQPHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |