C12H15Cl2F4N — CID 171228872
(1S)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride (PubChem CID 171228872) has the molecular formula C12H15Cl2F4N and a molecular weight of 320.16 g/mol. Its IUPAC name is (1S)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171228872 |
| Molecular Formula | C12H15Cl2F4N |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (1S)-1-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@H](N)c1c(C(F)(F)F)ccc(Cl)c1F.Cl |
| InChI | InChI=1S/C12H14ClF4N.ClH/c1-3-6(2)11(18)9-7(12(15,16)17)4-5-8(13)10(9)14;/h4-6,11H,3,18H2,1-2H3;1H/t6?,11-;/m0./s1 |
| InChIKey | MOSDQBLLARSSSP-JVNPWACXSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |