C12H16Cl2F3N — CID 171209424
(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride (PubChem CID 171209424) has the molecular formula C12H16Cl2F3N and a molecular weight of 302.17 g/mol. Its IUPAC name is (1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171209424 |
| Molecular Formula | C12H16Cl2F3N |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]-2-methylbutan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@@H](N)c1cccc(C(F)(F)F)c1Cl.Cl |
| InChI | InChI=1S/C12H15ClF3N.ClH/c1-3-7(2)11(17)8-5-4-6-9(10(8)13)12(14,15)16;/h4-7,11H,3,17H2,1-2H3;1H/t7?,11-;/m1./s1 |
| InChIKey | LLQQQOLSACRRIR-HYEBNMQDSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |