C12H15F4N — CID 171231048
(1S)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutan-1-amine (PubChem CID 171231048) has the molecular formula C12H15F4N and a molecular weight of 249.25 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutan-1-amine.
| Compound Name | (1S)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 171231048 |
| Molecular Formula | C12H15F4N |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (1S)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)[C@H](N)c1cccc(F)c1C(F)(F)F |
| InChI | InChI=1S/C12H15F4N/c1-3-7(2)11(17)8-5-4-6-9(13)10(8)12(14,15)16/h4-7,11H,3,17H2,1-2H3/t7?,11-/m0/s1 |
| InChIKey | IZPOUBQATUVGLQ-QRIDDKLISA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |