C11H12ClF4N — CID 171211419
(1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride (PubChem CID 171211419) has the molecular formula C11H12ClF4N and a molecular weight of 269.67 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171211419 |
| Molecular Formula | C11H12ClF4N |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cccc(F)c1C(F)(F)F.Cl |
| InChI | InChI=1S/C11H11F4N.ClH/c1-2-4-9(16)7-5-3-6-8(12)10(7)11(13,14)15;/h2-3,5-6,9H,1,4,16H2;1H/t9-;/m1./s1 |
| InChIKey | PUJXLJHTCFJITG-SBSPUUFOSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|