C12H16ClF4N — CID 171211425
(1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 171211425) has the molecular formula C12H16ClF4N and a molecular weight of 285.71 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171211425 |
| Molecular Formula | C12H16ClF4N |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (1R)-1-[3-fluoro-2-(trifluoromethyl)phenyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@@H](N)c1cccc(F)c1C(F)(F)F.Cl |
| InChI | InChI=1S/C12H15F4N.ClH/c1-7(2)6-10(17)8-4-3-5-9(13)11(8)12(14,15)16;/h3-5,7,10H,6,17H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | MWBAAHOVZCZYEN-HNCPQSOCSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |