C10H16ClFN2 — CID 171222925
(1S)-1-(2-fluoro-3-pyridinyl)-3-methylbutan-1-amine;hydrochloride (PubChem CID 171222925) has the molecular formula C10H16ClFN2 and a molecular weight of 218.70 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-3-pyridinyl)-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-fluoro-3-pyridinyl)-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171222925 |
| Molecular Formula | C10H16ClFN2 |
| Molecular Weight | 218.70 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (1S)-1-(2-fluoro-3-pyridinyl)-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)C[C@H](N)c1cccnc1F.Cl |
| InChI | InChI=1S/C10H15FN2.ClH/c1-7(2)6-9(12)8-4-3-5-13-10(8)11;/h3-5,7,9H,6,12H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | IRLYIPQOLQIZPQ-FVGYRXGTSA-N |
| XLogP | 2.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|