C8H9ClF4N2 — CID 171222927
(1S)-3,3,3-trifluoro-1-(2-fluoro-3-pyridinyl)propan-1-amine;hydrochloride (PubChem CID 171222927) has the molecular formula C8H9ClF4N2 and a molecular weight of 244.62 g/mol. Its IUPAC name is (1S)-3,3,3-trifluoro-1-(2-fluoro-3-pyridinyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-3,3,3-trifluoro-1-(2-fluoro-3-pyridinyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171222927 |
| Molecular Formula | C8H9ClF4N2 |
| Molecular Weight | 244.62 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | (1S)-3,3,3-trifluoro-1-(2-fluoro-3-pyridinyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CC(F)(F)F)c1cccnc1F |
| InChI | InChI=1S/C8H8F4N2.ClH/c9-7-5(2-1-3-14-7)6(13)4-8(10,11)12;/h1-3,6H,4,13H2;1H/t6-;/m0./s1 |
| InChIKey | ONBFGMJWKDTSDS-RGMNGODLSA-N |
| XLogP | 2.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|